C33H47NO2 — CID 123960568
6a,6b,8a,11,14a-pentamethyl-4-methylidene-11-(pyrrolidin-1-ylmethyl)-7,8,9,10,12,12a,13,14-octahydropicene-2,3-diol (PubChem CID 123960568) has the molecular formula C33H47NO2 and a molecular weight of 489.74 g/mol. Its IUPAC name is 6a,6b,8a,11,14a-pentamethyl-4-methylidene-11-(pyrrolidin-1-ylmethyl)-7,8,9,10,12,12a,13,14-octahydropicene-2,3-diol.
| Compound Name | 6a,6b,8a,11,14a-pentamethyl-4-methylidene-11-(pyrrolidin-1-ylmethyl)-7,8,9,10,12,12a,13,14-octahydropicene-2,3-diol |
|---|---|
| PubChem CID | 123960568 |
| Molecular Formula | C33H47NO2 |
| Molecular Weight | 489.74 g/mol |
| Exact Mass | 489.36 |
| IUPAC Name | 6a,6b,8a,11,14a-pentamethyl-4-methylidene-11-(pyrrolidin-1-ylmethyl)-7,8,9,10,12,12a,13,14-octahydropicene-2,3-diol |
| SMILES | C=c1c(O)c(O)cc2c1=CC=C1C2(C)CCC2(C)C3CC(C)(CN4CCCC4)CCC3(C)CCC12C |
| InChI | InChI=1S/C33H47NO2/c1-22-23-9-10-26-31(4,24(23)19-25(35)28(22)36)14-16-33(6)27-20-29(2,21-34-17-7-8-18-34)11-12-30(27,3)13-15-32(26,33)5/h9-10,19,27,35-36H,1,7-8,11-18,20-21H2,2-6H3 |
| InChIKey | XFYCAOVGQUVWQC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.74 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|