C61H46N4 — CID 123960631
N-benzyl-1-[9,9-dimethyl-7-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]fluoren-2-yl]-3-phenylpropane-1,3-diimine (PubChem CID 123960631) has the molecular formula C61H46N4 and a molecular weight of 835.07 g/mol. Its IUPAC name is N-benzyl-1-[9,9-dimethyl-7-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]fluoren-2-yl]-3-phenylpropane-1,3-diimine.
| Compound Name | N-benzyl-1-[9,9-dimethyl-7-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]fluoren-2-yl]-3-phenylpropane-1,3-diimine |
|---|---|
| PubChem CID | 123960631 |
| Molecular Formula | C61H46N4 |
| Molecular Weight | 835.07 g/mol |
| Exact Mass | 834.37 |
| IUPAC Name | N-benzyl-1-[9,9-dimethyl-7-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]fluoren-2-yl]-3-phenylpropane-1,3-diimine |
| SMILES | [H]/N=C(/C/C(=N\Cc1ccccc1)c1ccc2c(c1)C(C)(C)c1cc(-n3c4ccccc4c4cc(-c5ccc6c(c5)c5ccccc5n6-c5ccccc5)ccc43)ccc1-2)c1ccccc1 |
| InChI | InChI=1S/C61H46N4/c1-61(2)53-36-44(56(63-39-40-16-6-3-7-17-40)38-55(62)41-18-8-4-9-19-41)26-30-47(53)48-31-29-46(37-54(48)61)65-58-25-15-13-23-50(58)52-35-43(28-33-60(52)65)42-27-32-59-51(34-42)49-22-12-14-24-57(49)64(59)45-20-10-5-11-21-45/h3-37,62H,38-39H2,1-2H3/b62-55-,63-56+ |
| InChIKey | KCZXKFALHNLFCJ-PUWYIAGOSA-N |
| XLogP | 15.30 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.07 |
| LogP ≤ 5 | 15.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|