C26H41NO3 — CID 123960788
1-icosa-5,8,11,14-tetraenoylpiperidine-3-carboxylic acid (PubChem CID 123960788) has the molecular formula C26H41NO3 and a molecular weight of 415.62 g/mol. Its IUPAC name is 1-icosa-5,8,11,14-tetraenoylpiperidine-3-carboxylic acid.
| Compound Name | 1-icosa-5,8,11,14-tetraenoylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 123960788 |
| Molecular Formula | C26H41NO3 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | 1-icosa-5,8,11,14-tetraenoylpiperidine-3-carboxylic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C26H41NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-25(28)27-22-19-20-24(23-27)26(29)30/h6-7,9-10,12-13,15-16,24H,2-5,8,11,14,17-23H2,1H3,(H,29,30) |
| InChIKey | HLKOSHZRSNSPOQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|