C18H8N2O4 — CID 123961034
4,13-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1,6,8,10(20),11(19),15,17-heptaene-3,5,12,14-tetrone (PubChem CID 123961034) has the molecular formula C18H8N2O4 and a molecular weight of 316.27 g/mol. Its IUPAC name is 4,13-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1,6,8,10(20),11(19),15,17-heptaene-3,5,12,14-tetrone.
| Compound Name | 4,13-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1,6,8,10(20),11(19),15,17-heptaene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 123961034 |
| Molecular Formula | C18H8N2O4 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4,13-diazapentacyclo[9.7.1.12,6.015,19.010,20]icosa-1,6,8,10(20),11(19),15,17-heptaene-3,5,12,14-tetrone |
| SMILES | O=c1[nH]c(=O)c2c3cccc4c(=O)[nH]c(=O)c(c5cccc1c52)c43 |
| InChI | InChI=1S/C18H8N2O4/c21-15-9-5-1-3-7-11(9)14(18(24)19-15)8-4-2-6-10-12(8)13(7)17(23)20-16(10)22/h1-6H,(H,19,21,24)(H,20,22,23) |
| InChIKey | GBBBCCSVJRPVGY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|