About 2,5-dimethyl-4H-imidazole;ethane
2,5-dimethyl-4H-imidazole;ethane (PubChem CID 123961103) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 2,5-dimethyl-4H-imidazole;ethane.
Molecular Properties
| Compound Name | 2,5-dimethyl-4H-imidazole;ethane |
| PubChem CID | 123961103 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2,5-dimethyl-4H-imidazole;ethane |
| SMILES | CC.CC1=NC(C)=NC1 |
| InChI | InChI=1S/C5H8N2.C2H6/c1-4-3-6-5(2)7-4;1-2/h3H2,1-2H3;1-2H3 |
| InChIKey | MOQBOZDYZUYUJB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dimethyl-4H-imidazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4H-imidazole;ethane?
The IUPAC name of 2,5-dimethyl-4H-imidazole;ethane (CID 123961103) is 2,5-dimethyl-4H-imidazole;ethane.
What is the SMILES notation for 2,5-dimethyl-4H-imidazole;ethane?
The canonical SMILES for 2,5-dimethyl-4H-imidazole;ethane is CC.CC1=NC(C)=NC1.
What is the InChIKey of 2,5-dimethyl-4H-imidazole;ethane?
The InChIKey is MOQBOZDYZUYUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.C2H6/c1-4-3-6-5(2)7-4;1-2/h3H2,1-2H3;1-2H3.
What are the key properties of 2,5-dimethyl-4H-imidazole;ethane?
2,5-dimethyl-4H-imidazole;ethane has a molecular weight of 126.20 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4H-imidazole;ethane is sourced from PubChem (CID 123961103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).