C24H26ClN7O2 — CID 123961186
(Z)-1-[(3R)-3-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one (PubChem CID 123961186) has the molecular formula C24H26ClN7O2 and a molecular weight of 479.97 g/mol. Its IUPAC name is (Z)-1-[(3R)-3-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one.
| Compound Name | (Z)-1-[(3R)-3-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one |
|---|---|
| PubChem CID | 123961186 |
| Molecular Formula | C24H26ClN7O2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (Z)-1-[(3R)-3-[4-amino-3-(4-chloro-3-hydroxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-2-isocyano-4,4-dimethylpent-2-en-1-one |
| SMILES | [C-]#[N+]/C(=C\C(C)(C)C)C(=O)N1CCC[C@@H](n2nc(-c3ccc(Cl)c(O)c3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C24H26ClN7O2/c1-24(2,3)11-17(27-4)23(34)31-9-5-6-15(12-31)32-22-19(21(26)28-13-29-22)20(30-32)14-7-8-16(25)18(33)10-14/h7-8,10-11,13,15,33H,5-6,9,12H2,1-3H3,(H2,26,28,29)/b17-11-/t15-/m1/s1 |
| InChIKey | QFGNKRFGJLTELW-QJISPJEISA-N |
| XLogP | 4.45 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|