About cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate
cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate (PubChem CID 123961314) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate |
| PubChem CID | 123961314 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate |
| SMILES | CC(N)C1CCN(C(=O)OCC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C15H24N2O2/c1-12(16)14-7-9-17(10-8-14)15(18)19-11-13-5-3-2-4-6-13/h3,5-6,12,14H,2,4,7-11,16H2,1H3 |
| InChIKey | FRZXRJRVMOZNTO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate (CID 123961314) is cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate is CC(N)C1CCN(C(=O)OCC2=CCCC=C2)CC1.
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate?
The InChIKey is FRZXRJRVMOZNTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-12(16)14-7-9-17(10-8-14)15(18)19-11-13-5-3-2-4-6-13/h3,5-6,12,14H,2,4,7-11,16H2,1H3.
What are the key properties of cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate?
cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate has a molecular weight of 264.37 g/mol, XLogP of 2.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethyl 4-(1-aminoethyl)piperidine-1-carboxylate is sourced from PubChem (CID 123961314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).