C16H19F3N4O2 — CID 123961632
[(1-methylpiperidin-3-yl)amino]-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol (PubChem CID 123961632) has the molecular formula C16H19F3N4O2 and a molecular weight of 356.35 g/mol. Its IUPAC name is [(1-methylpiperidin-3-yl)amino]-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol.
| Compound Name | [(1-methylpiperidin-3-yl)amino]-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 123961632 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [(1-methylpiperidin-3-yl)amino]-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methanol |
| SMILES | CN1CCCC(NC(O)c2ccc(-c3noc(C(F)(F)F)n3)cc2)C1 |
| InChI | InChI=1S/C16H19F3N4O2/c1-23-8-2-3-12(9-23)20-14(24)11-6-4-10(5-7-11)13-21-15(25-22-13)16(17,18)19/h4-7,12,14,20,24H,2-3,8-9H2,1H3 |
| InChIKey | NFWLDUTYISWYST-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|