C20H21F2N3O3S — CID 123962444
2-aminosulfanyl-N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-3-methyliminopentanamide (PubChem CID 123962444) has the molecular formula C20H21F2N3O3S and a molecular weight of 421.47 g/mol. Its IUPAC name is 2-aminosulfanyl-N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-3-methyliminopentanamide.
| Compound Name | 2-aminosulfanyl-N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-3-methyliminopentanamide |
|---|---|
| PubChem CID | 123962444 |
| Molecular Formula | C20H21F2N3O3S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 2-aminosulfanyl-N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-3-methyliminopentanamide |
| SMILES | CC/C(=N\C)C(SN)C(=O)Nc1ccc(-c2cc3c(cc2C)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C20H21F2N3O3S/c1-4-15(24-3)18(29-23)19(26)25-13-7-5-12(6-8-13)14-10-17-16(9-11(14)2)27-20(21,22)28-17/h5-10,18H,4,23H2,1-3H3,(H,25,26)/b24-15+ |
| InChIKey | GYDWRMKNYHSJBB-BUVRLJJBSA-N |
| XLogP | 4.38 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|