C23H25NO5 — CID 123962455
(6'S,6'aS,9'aS)-6'a-hydroxy-6',9'a-dimethyl-3-(3-methylphenyl)spiro[2H-1,2-oxazole-5,3'-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan]-2',9'-dione (PubChem CID 123962455) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is (6'S,6'aS,9'aS)-6'a-hydroxy-6',9'a-dimethyl-3-(3-methylphenyl)spiro[2H-1,2-oxazole-5,3'-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan]-2',9'-dione.
| Compound Name | (6'S,6'aS,9'aS)-6'a-hydroxy-6',9'a-dimethyl-3-(3-methylphenyl)spiro[2H-1,2-oxazole-5,3'-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan]-2',9'-dione |
|---|---|
| PubChem CID | 123962455 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (6'S,6'aS,9'aS)-6'a-hydroxy-6',9'a-dimethyl-3-(3-methylphenyl)spiro[2H-1,2-oxazole-5,3'-4,5,6,9b-tetrahydro-3aH-azuleno[8,7-b]furan]-2',9'-dione |
| SMILES | Cc1cccc(C2=CC3(ON2)C(=O)OC2C3CC[C@H](C)[C@]3(O)C=CC(=O)[C@@]23C)c1 |
| InChI | InChI=1S/C23H25NO5/c1-13-5-4-6-15(11-13)17-12-22(29-24-17)16-8-7-14(2)23(27)10-9-18(25)21(23,3)19(16)28-20(22)26/h4-6,9-12,14,16,19,24,27H,7-8H2,1-3H3/t14-,16?,19?,21-,22?,23+/m0/s1 |
| InChIKey | RWNUCCADRNAEAN-YVHWSJASSA-N |
| XLogP | 2.46 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |