C13H18FN3O3 — CID 123962801
2-[[2-fluoro-4-(N'-hydroxycarbamimidoyl)phenyl]methyl-methylamino]-2-methylpropanoic acid (PubChem CID 123962801) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is 2-[[2-fluoro-4-(N'-hydroxycarbamimidoyl)phenyl]methyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 2-[[2-fluoro-4-(N'-hydroxycarbamimidoyl)phenyl]methyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 123962801 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-[[2-fluoro-4-(N'-hydroxycarbamimidoyl)phenyl]methyl-methylamino]-2-methylpropanoic acid |
| SMILES | CN(Cc1ccc(C(N)=NO)cc1F)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H18FN3O3/c1-13(2,12(18)19)17(3)7-9-5-4-8(6-10(9)14)11(15)16-20/h4-6,20H,7H2,1-3H3,(H2,15,16)(H,18,19) |
| InChIKey | LFSJAJMLNRCSSN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|