C9H18N2 — CID 123963604
2-N-ethyl-5-methylhexane-2,4-diimine (PubChem CID 123963604) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-N-ethyl-5-methylhexane-2,4-diimine.
| Compound Name | 2-N-ethyl-5-methylhexane-2,4-diimine |
|---|---|
| PubChem CID | 123963604 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-N-ethyl-5-methylhexane-2,4-diimine |
| SMILES | [H]/N=C(/C/C(C)=N/CC)C(C)C |
| InChI | InChI=1S/C9H18N2/c1-5-11-8(4)6-9(10)7(2)3/h7,10H,5-6H2,1-4H3/b10-9-,11-8+ |
| InChIKey | JQADCSBVOKIRGO-LMMFKTOUSA-N |
| XLogP | 2.53 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|