About 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol
4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol (PubChem CID 123963648) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol |
| PubChem CID | 123963648 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol |
| SMILES | C=c1cc(O)ccc1=CC(CCCC)CC(C)N |
| InChI | InChI=1S/C16H25NO/c1-4-5-6-14(10-13(3)17)11-15-7-8-16(18)9-12(15)2/h7-9,11,13-14,18H,2,4-6,10,17H2,1,3H3 |
| InChIKey | KIPRDGVAHLZCMJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol?
The IUPAC name of 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol (CID 123963648) is 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol?
The canonical SMILES for 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol is C=c1cc(O)ccc1=CC(CCCC)CC(C)N.
What is the InChIKey of 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol?
The InChIKey is KIPRDGVAHLZCMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO/c1-4-5-6-14(10-13(3)17)11-15-7-8-16(18)9-12(15)2/h7-9,11,13-14,18H,2,4-6,10,17H2,1,3H3.
What are the key properties of 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol?
4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol has a molecular weight of 247.38 g/mol, XLogP of 2.13, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-aminopropyl)hexylidene]-3-methylidenecyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 123963648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).