About (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol
(3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol (PubChem CID 1239638) has the molecular formula C8H17NO3S
and a molecular weight of 207.29 g/mol. Its IUPAC name is (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol |
| PubChem CID | 1239638 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol |
| SMILES | CC(C)CN[C@@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C8H17NO3S/c1-6(2)3-9-7-4-13(11,12)5-8(7)10/h6-10H,3-5H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | ASXXODVEVSEVMM-SFYZADRCSA-N |
| XLogP | -0.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol?
The IUPAC name of (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol (CID 1239638) is (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol.
What is the SMILES notation for (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol?
The canonical SMILES for (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol is CC(C)CN[C@@H]1CS(=O)(=O)C[C@@H]1O.
What is the InChIKey of (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol?
The InChIKey is ASXXODVEVSEVMM-SFYZADRCSA-N. The full InChI is InChI=1S/C8H17NO3S/c1-6(2)3-9-7-4-13(11,12)5-8(7)10/h6-10H,3-5H2,1-2H3/t7-,8+/m1/s1.
What are the key properties of (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol?
(3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol has a molecular weight of 207.29 g/mol, XLogP of -0.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-(2-methylpropylamino)-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 1239638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).