About 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide
4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide (PubChem CID 123964128) has the molecular formula C12H19F2NO
and a molecular weight of 231.29 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide |
| PubChem CID | 123964128 |
| Molecular Formula | C12H19F2NO |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide |
| SMILES | CCC(=CC(=C(C)CC)C(F)F)C(=O)NC |
| InChI | InChI=1S/C12H19F2NO/c1-5-8(3)10(11(13)14)7-9(6-2)12(16)15-4/h7,11H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | JIGCHFQXVDRLKO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide?
The IUPAC name of 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide (CID 123964128) is 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide.
What is the SMILES notation for 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide?
The canonical SMILES for 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide is CCC(=CC(=C(C)CC)C(F)F)C(=O)NC.
What is the InChIKey of 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide?
The InChIKey is JIGCHFQXVDRLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2NO/c1-5-8(3)10(11(13)14)7-9(6-2)12(16)15-4/h7,11H,5-6H2,1-4H3,(H,15,16).
What are the key properties of 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide?
4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide has a molecular weight of 231.29 g/mol, XLogP of 3.06, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-2-ethyl-N,5-dimethylhepta-2,4-dienamide is sourced from PubChem (CID 123964128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).