About N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium
N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium (PubChem CID 123964141) has the molecular formula C24H30N+
and a molecular weight of 332.51 g/mol. Its IUPAC name is N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium.
Molecular Properties
| Compound Name | N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium |
| PubChem CID | 123964141 |
| Molecular Formula | C24H30N+ |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium |
| SMILES | CC=CC(C)C=CC#[N+]CC1(C)C=CC2=C(C=CC(CC)C=C2)C=C1 |
| InChI | InChI=1S/C24H30N/c1-5-8-20(3)9-7-18-25-19-24(4)16-14-22-12-10-21(6-2)11-13-23(22)15-17-24/h5,7-17,20-21H,6,19H2,1-4H3/q+1 |
| InChIKey | SMUKQVHVVVGXGU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium?
The IUPAC name of N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium (CID 123964141) is N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium.
What is the SMILES notation for N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium?
The canonical SMILES for N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium is CC=CC(C)C=CC#[N+]CC1(C)C=CC2=C(C=CC(CC)C=C2)C=C1.
What is the InChIKey of N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium?
The InChIKey is SMUKQVHVVVGXGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N/c1-5-8-20(3)9-7-18-25-19-24(4)16-14-22-12-10-21(6-2)11-13-23(22)15-17-24/h5,7-17,20-21H,6,19H2,1-4H3/q+1.
What are the key properties of N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium?
N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium has a molecular weight of 332.51 g/mol, XLogP of 6.67, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(8-ethyl-3-methyl-8H-heptalen-3-yl)methyl]-4-methylhepta-2,5-dienenitrilium is sourced from PubChem (CID 123964141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).