C28H22ClN5O3 — CID 123964159
9-chloro-1-[4-(2-isocyanopropan-2-yl)phenyl]-3-[(4-methoxyphenyl)methyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 123964159) has the molecular formula C28H22ClN5O3 and a molecular weight of 511.97 g/mol. Its IUPAC name is 9-chloro-1-[4-(2-isocyanopropan-2-yl)phenyl]-3-[(4-methoxyphenyl)methyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-chloro-1-[4-(2-isocyanopropan-2-yl)phenyl]-3-[(4-methoxyphenyl)methyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 123964159 |
| Molecular Formula | C28H22ClN5O3 |
| Molecular Weight | 511.97 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 9-chloro-1-[4-(2-isocyanopropan-2-yl)phenyl]-3-[(4-methoxyphenyl)methyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | [C-]#[N+]C(C)(C)c1ccc(-n2c(=O)n(Cc3ccc(OC)cc3)c(=O)c3cnc4ccc(Cl)nc4c32)cc1 |
| InChI | InChI=1S/C28H22ClN5O3/c1-28(2,30-3)18-7-9-19(10-8-18)34-25-21(15-31-22-13-14-23(29)32-24(22)25)26(35)33(27(34)36)16-17-5-11-20(37-4)12-6-17/h5-15H,16H2,1-2,4H3 |
| InChIKey | PZHOYVIGUFANKW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 83.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.97 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|