About ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate
ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate (PubChem CID 123964385) has the molecular formula C22H30FNO2
and a molecular weight of 359.49 g/mol. Its IUPAC name is ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate |
| PubChem CID | 123964385 |
| Molecular Formula | C22H30FNO2 |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate |
| SMILES | CCOC(=O)C1C2CC3CC(CC(C3)CC1NCc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C22H30FNO2/c1-2-26-22(25)21-18-10-15-7-16(11-18)9-17(8-15)12-20(21)24-13-14-3-5-19(23)6-4-14/h3-6,15-18,20-21,24H,2,7-13H2,1H3 |
| InChIKey | KNYNWYMIOJEWLM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate?
The IUPAC name of ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate (CID 123964385) is ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate.
What is the SMILES notation for ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate?
The canonical SMILES for ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate is CCOC(=O)C1C2CC3CC(CC(C3)CC1NCc1ccc(F)cc1)C2.
What is the InChIKey of ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate?
The InChIKey is KNYNWYMIOJEWLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30FNO2/c1-2-26-22(25)21-18-10-15-7-16(11-18)9-17(8-15)12-20(21)24-13-14-3-5-19(23)6-4-14/h3-6,15-18,20-21,24H,2,7-13H2,1H3.
What are the key properties of ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate?
ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate has a molecular weight of 359.49 g/mol, XLogP of 4.31, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[(4-fluorophenyl)methylamino]tricyclo[5.3.1.13,9]dodecane-4-carboxylate is sourced from PubChem (CID 123964385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).