C18H23F13OSi — CID 123964640
dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane (PubChem CID 123964640) has the molecular formula C18H23F13OSi and a molecular weight of 530.44 g/mol. Its IUPAC name is dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane.
| Compound Name | dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
|---|---|
| PubChem CID | 123964640 |
| Molecular Formula | C18H23F13OSi |
| Molecular Weight | 530.44 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | dimethyl-[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| SMILES | C[Si](C)(CCC1CCC2OC2C1)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H23F13OSi/c1-33(2,7-5-10-3-4-11-12(9-10)32-11)8-6-13(19,20)14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)31/h10-12H,3-9H2,1-2H3 |
| InChIKey | CQYKNGFQWFTPTO-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.44 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|