C20H26N6O4S — CID 123964772
N-[1-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethyl]piperidin-4-yl]methanesulfonamide (PubChem CID 123964772) has the molecular formula C20H26N6O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[1-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 123964772 |
| Molecular Formula | C20H26N6O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[1-[2-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-3-yl)ethyl]piperidin-4-yl]methanesulfonamide |
| SMILES | Cc1cc2nc3[nH]c(=O)n(CCN4CCC(NS(C)(=O)=O)CC4)c(=O)c3nc2cc1C |
| InChI | InChI=1S/C20H26N6O4S/c1-12-10-15-16(11-13(12)2)22-18-17(21-15)19(27)26(20(28)23-18)9-8-25-6-4-14(5-7-25)24-31(3,29)30/h10-11,14,24H,4-9H2,1-3H3,(H,22,23,28) |
| InChIKey | FHOCORSSOYZEES-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 130.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|