C14H24N5+ — CID 123965054
cyclohepta-1,3-dien-1-ylmethyl-[3-(dimethylamino)-1H-1,2,4-triazol-5-yl]-dimethylazanium (PubChem CID 123965054) has the molecular formula C14H24N5+ and a molecular weight of 262.38 g/mol. Its IUPAC name is cyclohepta-1,3-dien-1-ylmethyl-[3-(dimethylamino)-1H-1,2,4-triazol-5-yl]-dimethylazanium.
| Compound Name | cyclohepta-1,3-dien-1-ylmethyl-[3-(dimethylamino)-1H-1,2,4-triazol-5-yl]-dimethylazanium |
|---|---|
| PubChem CID | 123965054 |
| Molecular Formula | C14H24N5+ |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | cyclohepta-1,3-dien-1-ylmethyl-[3-(dimethylamino)-1H-1,2,4-triazol-5-yl]-dimethylazanium |
| SMILES | CN(C)c1n[nH]c([N+](C)(C)CC2=CC=CCCC2)n1 |
| InChI | InChI=1S/C14H24N5/c1-18(2)13-15-14(17-16-13)19(3,4)11-12-9-7-5-6-8-10-12/h5,7,9H,6,8,10-11H2,1-4H3,(H,15,16,17)/q+1 |
| InChIKey | VKUQENPLXAYXFI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|