C26H34N6O3 — CID 123965555
[2-(azidomethyl)morpholin-4-yl]-[6-butyl-5-(4-cyclohexyloxyphenyl)pyridazin-3-yl]methanone (PubChem CID 123965555) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is [2-(azidomethyl)morpholin-4-yl]-[6-butyl-5-(4-cyclohexyloxyphenyl)pyridazin-3-yl]methanone.
| Compound Name | [2-(azidomethyl)morpholin-4-yl]-[6-butyl-5-(4-cyclohexyloxyphenyl)pyridazin-3-yl]methanone |
|---|---|
| PubChem CID | 123965555 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | [2-(azidomethyl)morpholin-4-yl]-[6-butyl-5-(4-cyclohexyloxyphenyl)pyridazin-3-yl]methanone |
| SMILES | CCCCc1nnc(C(=O)N2CCOC(CN=[N+]=[N-])C2)cc1-c1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H34N6O3/c1-2-3-9-24-23(19-10-12-21(13-11-19)35-20-7-5-4-6-8-20)16-25(30-29-24)26(33)32-14-15-34-22(18-32)17-28-31-27/h10-13,16,20,22H,2-9,14-15,17-18H2,1H3 |
| InChIKey | BSHZGRNYDOPXRJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 113.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|