C26H28BN2O2 — CID 123965856
CID 123965856 (PubChem CID 123965856) has the molecular formula C26H28BN2O2 and a molecular weight of 411.33 g/mol.
| Compound Name | CID 123965856 |
|---|---|
| PubChem CID | 123965856 |
| Molecular Formula | C26H28BN2O2 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | — |
| SMILES | CC(C)C(O[B]c1ccc(-c2nc3ccccc3n2-c2ccccc2)cc1)C(C)(C)O |
| InChI | InChI=1S/C26H28BN2O2/c1-18(2)24(26(3,4)30)31-27-20-16-14-19(15-17-20)25-28-22-12-8-9-13-23(22)29(25)21-10-6-5-7-11-21/h5-18,24,30H,1-4H3 |
| InChIKey | FKFLUXHHNYZKSP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|