C32H48O7 — CID 123966705
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl icosa-5,8,11,14,17-pentaenoate (PubChem CID 123966705) has the molecular formula C32H48O7 and a molecular weight of 544.73 g/mol. Its IUPAC name is [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl icosa-5,8,11,14,17-pentaenoate.
| Compound Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl icosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 123966705 |
| Molecular Formula | C32H48O7 |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl icosa-5,8,11,14,17-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC[C@@]12OC[C@H]3OC(C)(C)O[C@H]3[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C32H48O7/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-27(33)34-25-32-29(38-31(4,5)39-32)28-26(24-35-32)36-30(2,3)37-28/h7-8,10-11,13-14,16-17,19-20,26,28-29H,6,9,12,15,18,21-25H2,1-5H3/t26-,28-,29+,32+/m1/s1 |
| InChIKey | QDBVIMOFLRBZLK-JIPLTUAOSA-N |
| XLogP | 6.85 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|