C14H33NSi — CID 123967550
N,N-diethyl-2,2,4,4-tetramethyl-3-(silylmethyl)pentan-3-amine (PubChem CID 123967550) has the molecular formula C14H33NSi and a molecular weight of 243.51 g/mol. Its IUPAC name is N,N-diethyl-2,2,4,4-tetramethyl-3-(silylmethyl)pentan-3-amine.
| Compound Name | N,N-diethyl-2,2,4,4-tetramethyl-3-(silylmethyl)pentan-3-amine |
|---|---|
| PubChem CID | 123967550 |
| Molecular Formula | C14H33NSi |
| Molecular Weight | 243.51 g/mol |
| Exact Mass | 243.24 |
| IUPAC Name | N,N-diethyl-2,2,4,4-tetramethyl-3-(silylmethyl)pentan-3-amine |
| SMILES | CCN(CC)C(C[SiH3])(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H33NSi/c1-9-15(10-2)14(11-16,12(3,4)5)13(6,7)8/h9-11H2,1-8,16H3 |
| InChIKey | VVBXZBAPANIQBA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|