About 1-(3-methoxybuta-1,3-dien-2-yl)piperazine
1-(3-methoxybuta-1,3-dien-2-yl)piperazine (PubChem CID 123967641) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(3-methoxybuta-1,3-dien-2-yl)piperazine.
Molecular Properties
| Compound Name | 1-(3-methoxybuta-1,3-dien-2-yl)piperazine |
| PubChem CID | 123967641 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-(3-methoxybuta-1,3-dien-2-yl)piperazine |
| SMILES | C=C(OC)C(=C)N1CCNCC1 |
| InChI | InChI=1S/C9H16N2O/c1-8(9(2)12-3)11-6-4-10-5-7-11/h10H,1-2,4-7H2,3H3 |
| InChIKey | APIOCICWLKIQFG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methoxybuta-1,3-dien-2-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxybuta-1,3-dien-2-yl)piperazine?
The IUPAC name of 1-(3-methoxybuta-1,3-dien-2-yl)piperazine (CID 123967641) is 1-(3-methoxybuta-1,3-dien-2-yl)piperazine.
What is the SMILES notation for 1-(3-methoxybuta-1,3-dien-2-yl)piperazine?
The canonical SMILES for 1-(3-methoxybuta-1,3-dien-2-yl)piperazine is C=C(OC)C(=C)N1CCNCC1.
What is the InChIKey of 1-(3-methoxybuta-1,3-dien-2-yl)piperazine?
The InChIKey is APIOCICWLKIQFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-8(9(2)12-3)11-6-4-10-5-7-11/h10H,1-2,4-7H2,3H3.
What are the key properties of 1-(3-methoxybuta-1,3-dien-2-yl)piperazine?
1-(3-methoxybuta-1,3-dien-2-yl)piperazine has a molecular weight of 168.24 g/mol, XLogP of 0.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxybuta-1,3-dien-2-yl)piperazine is sourced from PubChem (CID 123967641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).