C22H32O4 — CID 123967698
7,10-dimethoxy-8,12,15,17-tetramethyl-4-oxapentacyclo[9.5.1.01,8.02,5.015,17]heptadec-10-en-9-one (PubChem CID 123967698) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 7,10-dimethoxy-8,12,15,17-tetramethyl-4-oxapentacyclo[9.5.1.01,8.02,5.015,17]heptadec-10-en-9-one.
| Compound Name | 7,10-dimethoxy-8,12,15,17-tetramethyl-4-oxapentacyclo[9.5.1.01,8.02,5.015,17]heptadec-10-en-9-one |
|---|---|
| PubChem CID | 123967698 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 7,10-dimethoxy-8,12,15,17-tetramethyl-4-oxapentacyclo[9.5.1.01,8.02,5.015,17]heptadec-10-en-9-one |
| SMILES | COC1=C2C(C)CCC3(C)CC4(C5COC5CC(OC)C4(C)C1=O)C23C |
| InChI | InChI=1S/C22H32O4/c1-12-7-8-19(2)11-22-13-10-26-14(13)9-15(24-5)20(22,3)18(23)17(25-6)16(12)21(19,22)4/h12-15H,7-11H2,1-6H3 |
| InChIKey | AGOILQBECVYVOV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |