C16H19N3O2 — CID 123967937
3-(5,6-dimethyl-2-morpholin-4-ylpyrimidin-4-yl)phenol (PubChem CID 123967937) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-(5,6-dimethyl-2-morpholin-4-ylpyrimidin-4-yl)phenol.
| Compound Name | 3-(5,6-dimethyl-2-morpholin-4-ylpyrimidin-4-yl)phenol |
|---|---|
| PubChem CID | 123967937 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-(5,6-dimethyl-2-morpholin-4-ylpyrimidin-4-yl)phenol |
| SMILES | Cc1nc(N2CCOCC2)nc(-c2cccc(O)c2)c1C |
| InChI | InChI=1S/C16H19N3O2/c1-11-12(2)17-16(19-6-8-21-9-7-19)18-15(11)13-4-3-5-14(20)10-13/h3-5,10,20H,6-9H2,1-2H3 |
| InChIKey | MTZWLZMPFDHQBG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |