C40H52O2S2Si2 — CID 123967972
[1-[(1R,2R)-2-(1-diphenylsilyloxy-2,2-dimethylpropyl)-3,3-bis(methylsulfanyl)cyclobutyl]-2,2-dimethylpropoxy]-diphenylsilane (PubChem CID 123967972) has the molecular formula C40H52O2S2Si2 and a molecular weight of 685.16 g/mol. Its IUPAC name is [1-[(1R,2R)-2-(1-diphenylsilyloxy-2,2-dimethylpropyl)-3,3-bis(methylsulfanyl)cyclobutyl]-2,2-dimethylpropoxy]-diphenylsilane.
| Compound Name | [1-[(1R,2R)-2-(1-diphenylsilyloxy-2,2-dimethylpropyl)-3,3-bis(methylsulfanyl)cyclobutyl]-2,2-dimethylpropoxy]-diphenylsilane |
|---|---|
| PubChem CID | 123967972 |
| Molecular Formula | C40H52O2S2Si2 |
| Molecular Weight | 685.16 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | [1-[(1R,2R)-2-(1-diphenylsilyloxy-2,2-dimethylpropyl)-3,3-bis(methylsulfanyl)cyclobutyl]-2,2-dimethylpropoxy]-diphenylsilane |
| SMILES | CSC1(SC)C[C@@H](C(O[SiH](c2ccccc2)c2ccccc2)C(C)(C)C)[C@@H]1C(O[SiH](c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C40H52O2S2Si2/c1-38(2,3)36(41-45(30-21-13-9-14-22-30)31-23-15-10-16-24-31)34-29-40(43-7,44-8)35(34)37(39(4,5)6)42-46(32-25-17-11-18-26-32)33-27-19-12-20-28-33/h9-28,34-37,45-46H,29H2,1-8H3/t34-,35-,36?,37?/m1/s1 |
| InChIKey | AKVKDKLUIQZLNT-WTNXRRHYSA-N |
| XLogP | 6.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.16 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|