C12H22N2+2 — CID 123968282
1-butyl-4,5,7-trimethyl-1,4-diazoniabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 123968282) has the molecular formula C12H22N2+2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-butyl-4,5,7-trimethyl-1,4-diazoniabicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 1-butyl-4,5,7-trimethyl-1,4-diazoniabicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 123968282 |
| Molecular Formula | C12H22N2+2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1-butyl-4,5,7-trimethyl-1,4-diazoniabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CCCC[N+]12C=C[N+](C)=C(C)C1C2C |
| InChI | InChI=1S/C12H22N2/c1-5-6-8-14-9-7-13(4)10(2)12(14)11(14)3/h7,9,11-12H,5-6,8H2,1-4H3/q+2 |
| InChIKey | QWZMIUUNOKAJQI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|