About 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine
2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine (PubChem CID 123968307) has the molecular formula C13H17BrN2S
and a molecular weight of 313.26 g/mol. Its IUPAC name is 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine.
Molecular Properties
| Compound Name | 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine |
| PubChem CID | 123968307 |
| Molecular Formula | C13H17BrN2S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine |
| SMILES | CCC1=CC(C)CC=C2C(SC)=CC(Br)=NN12 |
| InChI | InChI=1S/C13H17BrN2S/c1-4-10-7-9(2)5-6-11-12(17-3)8-13(14)15-16(10)11/h6-9H,4-5H2,1-3H3 |
| InChIKey | VDKUAPRQSAOSIG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine?
The IUPAC name of 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine (CID 123968307) is 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine.
What is the SMILES notation for 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine?
The canonical SMILES for 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine is CCC1=CC(C)CC=C2C(SC)=CC(Br)=NN12.
What is the InChIKey of 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine?
The InChIKey is VDKUAPRQSAOSIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrN2S/c1-4-10-7-9(2)5-6-11-12(17-3)8-13(14)15-16(10)11/h6-9H,4-5H2,1-3H3.
What are the key properties of 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine?
2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine has a molecular weight of 313.26 g/mol, XLogP of 4.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-9-ethyl-7-methyl-4-methylsulfanyl-6,7-dihydropyridazino[1,6-a]azepine is sourced from PubChem (CID 123968307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).