C11H18FNO — CID 123968379
(6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methanol (PubChem CID 123968379) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is (6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methanol.
| Compound Name | (6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methanol |
|---|---|
| PubChem CID | 123968379 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methanol |
| SMILES | C=C(C)C1(F)CN2CCCC2(CO)C1 |
| InChI | InChI=1S/C11H18FNO/c1-9(2)11(12)6-10(8-14)4-3-5-13(10)7-11/h14H,1,3-8H2,2H3 |
| InChIKey | YYMSTWVKQKCNQB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|