About N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine
N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine (PubChem CID 123968534) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine.
Molecular Properties
| Compound Name | N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine |
| PubChem CID | 123968534 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine |
| SMILES | CC=NN1C=C=CC=CC1=CC |
| InChI | InChI=1S/C10H12N2/c1-3-10-8-6-5-7-9-12(10)11-4-2/h3-6,8-9H,1-2H3 |
| InChIKey | RBXLHNFNQTVYKR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine?
The IUPAC name of N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine (CID 123968534) is N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine.
What is the SMILES notation for N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine?
The canonical SMILES for N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine is CC=NN1C=C=CC=CC1=CC.
What is the InChIKey of N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine?
The InChIKey is RBXLHNFNQTVYKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-3-10-8-6-5-7-9-12(10)11-4-2/h3-6,8-9H,1-2H3.
What are the key properties of N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine?
N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine has a molecular weight of 160.22 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethylidene-1-azacyclohepta-3,5,6-trien-1-yl)ethanimine is sourced from PubChem (CID 123968534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).