C35H27N3O2S2 — CID 123968706
3-methyl-5-[5-[7-(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-6-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]benzoic acid (PubChem CID 123968706) has the molecular formula C35H27N3O2S2 and a molecular weight of 585.75 g/mol. Its IUPAC name is 3-methyl-5-[5-[7-(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-6-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]benzoic acid.
| Compound Name | 3-methyl-5-[5-[7-(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-6-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 123968706 |
| Molecular Formula | C35H27N3O2S2 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | 3-methyl-5-[5-[7-(4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-6-yl)-2,1,3-benzothiadiazol-4-yl]thiophen-2-yl]benzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(-c2ccc(-c3ccc(-c4ccc5c(c4)N(c4ccccc4)C4CCCC54)c4nsnc34)s2)c1 |
| InChI | InChI=1S/C35H27N3O2S2/c1-20-16-22(18-23(17-20)35(39)40)31-14-15-32(41-31)28-13-12-25(33-34(28)37-42-36-33)21-10-11-27-26-8-5-9-29(26)38(30(27)19-21)24-6-3-2-4-7-24/h2-4,6-7,10-19,26,29H,5,8-9H2,1H3,(H,39,40) |
| InChIKey | OXZHGUHYKGYXLS-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |