C30H36N6O4Si — CID 123968801
7-[[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]methyl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one (PubChem CID 123968801) has the molecular formula C30H36N6O4Si and a molecular weight of 572.74 g/mol. Its IUPAC name is 7-[[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]methyl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one.
| Compound Name | 7-[[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]methyl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one |
|---|---|
| PubChem CID | 123968801 |
| Molecular Formula | C30H36N6O4Si |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 7-[[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]methyl]-5,6,8,8a-tetrahydro-1H-[1,3]oxazolo[3,4-a]pyrazin-3-one |
| SMILES | C[Si](C)(C)CCOCn1nccc1-c1ccc(Oc2ccc3nc(CN4CCN5C(=O)OCC5C4)ccc3c2)nc1 |
| InChI | InChI=1S/C30H36N6O4Si/c1-41(2,3)15-14-38-21-36-28(10-11-32-36)23-5-9-29(31-17-23)40-26-7-8-27-22(16-26)4-6-24(33-27)18-34-12-13-35-25(19-34)20-39-30(35)37/h4-11,16-17,25H,12-15,18-21H2,1-3H3 |
| InChIKey | LZUQETJPWXKPHF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 94.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|