C24H25Cl2NO3 — CID 123968815
(1S,5R)-3-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione (PubChem CID 123968815) has the molecular formula C24H25Cl2NO3 and a molecular weight of 446.37 g/mol. Its IUPAC name is (1S,5R)-3-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1S,5R)-3-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 123968815 |
| Molecular Formula | C24H25Cl2NO3 |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | (1S,5R)-3-[5-[(3,5-dichloro-2-pyridinyl)oxy]-2-ethylphenyl]-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(Oc2ncc(Cl)cc2Cl)cc1C1C(=O)[C@@H]2CC[C@](C)(C1=O)C2(C)C |
| InChI | InChI=1S/C24H25Cl2NO3/c1-5-13-6-7-15(30-22-18(26)10-14(25)12-27-22)11-16(13)19-20(28)17-8-9-24(4,21(19)29)23(17,2)3/h6-7,10-12,17,19H,5,8-9H2,1-4H3/t17-,19?,24+/m0/s1 |
| InChIKey | SGNMZKMXHLTOBL-YYXVYQJDSA-N |
| XLogP | 6.42 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|