C44H43F3N2O3 — CID 123968942
[[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(trifluoromethyl)phenyl]methylidene]amino] acetate (PubChem CID 123968942) has the molecular formula C44H43F3N2O3 and a molecular weight of 704.83 g/mol. Its IUPAC name is [[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(trifluoromethyl)phenyl]methylidene]amino] acetate.
| Compound Name | [[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(trifluoromethyl)phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 123968942 |
| Molecular Formula | C44H43F3N2O3 |
| Molecular Weight | 704.83 g/mol |
| Exact Mass | 704.32 |
| IUPAC Name | [[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(trifluoromethyl)phenyl]methylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=NOC(C)=O)c3ccccc3C(F)(F)F)cc2c2cc(C(=O)c3c(C)cc(C)cc3C)c3ccccc3c21 |
| InChI | InChI=1S/C44H43F3N2O3/c1-7-9-14-30(8-2)25-49-39-20-19-31(41(48-52-29(6)50)34-17-12-13-18-38(34)44(45,46)47)23-35(39)36-24-37(32-15-10-11-16-33(32)42(36)49)43(51)40-27(4)21-26(3)22-28(40)5/h10-13,15-24,30H,7-9,14,25H2,1-6H3 |
| InChIKey | AXAIKTKHQBBJSD-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.83 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|