C14H18F3N5O2S — CID 123969082
2-methyl-N-[5-(5-methyl-1,2-oxazol-3-yl)-1H-1,2,4-triazol-3-yl]-2-(4,4,4-trifluorobutylsulfanyl)propanamide (PubChem CID 123969082) has the molecular formula C14H18F3N5O2S and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-methyl-N-[5-(5-methyl-1,2-oxazol-3-yl)-1H-1,2,4-triazol-3-yl]-2-(4,4,4-trifluorobutylsulfanyl)propanamide.
| Compound Name | 2-methyl-N-[5-(5-methyl-1,2-oxazol-3-yl)-1H-1,2,4-triazol-3-yl]-2-(4,4,4-trifluorobutylsulfanyl)propanamide |
|---|---|
| PubChem CID | 123969082 |
| Molecular Formula | C14H18F3N5O2S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-methyl-N-[5-(5-methyl-1,2-oxazol-3-yl)-1H-1,2,4-triazol-3-yl]-2-(4,4,4-trifluorobutylsulfanyl)propanamide |
| SMILES | Cc1cc(-c2nc(NC(=O)C(C)(C)SCCCC(F)(F)F)n[nH]2)no1 |
| InChI | InChI=1S/C14H18F3N5O2S/c1-8-7-9(22-24-8)10-18-12(21-20-10)19-11(23)13(2,3)25-6-4-5-14(15,16)17/h7H,4-6H2,1-3H3,(H2,18,19,20,21,23) |
| InChIKey | MMMJSCBQQMVAHP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|