About (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane
(2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane (PubChem CID 123969334) has the molecular formula C18H33FOSi
and a molecular weight of 312.55 g/mol. Its IUPAC name is (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane |
| PubChem CID | 123969334 |
| Molecular Formula | C18H33FOSi |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane |
| SMILES | CC1=CC(C)C(CO[Si](C(C)C)(C(C)C)C(C)C)C(F)=C1 |
| InChI | InChI=1S/C18H33FOSi/c1-12(2)21(13(3)4,14(5)6)20-11-17-16(8)9-15(7)10-18(17)19/h9-10,12-14,16-17H,11H2,1-8H3 |
| InChIKey | PYUHRFLUSKIBOF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane?
The IUPAC name of (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane (CID 123969334) is (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane.
What is the SMILES notation for (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane?
The canonical SMILES for (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane is CC1=CC(C)C(CO[Si](C(C)C)(C(C)C)C(C)C)C(F)=C1.
What is the InChIKey of (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane?
The InChIKey is PYUHRFLUSKIBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33FOSi/c1-12(2)21(13(3)4,14(5)6)20-11-17-16(8)9-15(7)10-18(17)19/h9-10,12-14,16-17H,11H2,1-8H3.
What are the key properties of (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane?
(2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane has a molecular weight of 312.55 g/mol, XLogP of 6.24, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-4,6-dimethylcyclohexa-2,4-dien-1-yl)methoxy-tri(propan-2-yl)silane is sourced from PubChem (CID 123969334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).