C32H50 — CID 123969397
1-[2-(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 123969397) has the molecular formula C32H50 and a molecular weight of 434.75 g/mol. Its IUPAC name is 1-[2-(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 1-[2-(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 123969397 |
| Molecular Formula | C32H50 |
| Molecular Weight | 434.75 g/mol |
| Exact Mass | 434.39 |
| IUPAC Name | 1-[2-(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)ethyl]-2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CC1=C(C)C2C(C)C(C)C(CCC3C(C)C(C)C4C(C)=C(C)C(C)=C(C)C34)C2C(C)=C1C |
| InChI | InChI=1S/C32H50/c1-15-17(3)23(9)31-27(19(5)25(11)29(31)21(15)7)13-14-28-20(6)26(12)30-22(8)16(2)18(4)24(10)32(28)30/h19-20,25-32H,13-14H2,1-12H3 |
| InChIKey | FIYOHYFDPQCWDG-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.75 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |