About N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine
N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine (PubChem CID 123969404) has the molecular formula C8H17NOSi
and a molecular weight of 171.32 g/mol. Its IUPAC name is N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine.
Molecular Properties
| Compound Name | N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine |
| PubChem CID | 123969404 |
| Molecular Formula | C8H17NOSi |
| Molecular Weight | 171.32 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine |
| SMILES | C=CON=C([SiH3])C(C)(C)CC |
| InChI | InChI=1S/C8H17NOSi/c1-5-8(3,4)7(11)9-10-6-2/h6H,2,5H2,1,3-4,11H3 |
| InChIKey | LUQZSDMANWXEDX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine?
The IUPAC name of N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine (CID 123969404) is N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine.
What is the SMILES notation for N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine?
The canonical SMILES for N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine is C=CON=C([SiH3])C(C)(C)CC.
What is the InChIKey of N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine?
The InChIKey is LUQZSDMANWXEDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NOSi/c1-5-8(3,4)7(11)9-10-6-2/h6H,2,5H2,1,3-4,11H3.
What are the key properties of N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine?
N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine has a molecular weight of 171.32 g/mol, XLogP of 1.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenoxy-2,2-dimethyl-1-silylbutan-1-imine is sourced from PubChem (CID 123969404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).