About [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane
[(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane (PubChem CID 123969489) has the molecular formula C11H12Cl2FNOSi
and a molecular weight of 292.21 g/mol. Its IUPAC name is [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane.
Molecular Properties
| Compound Name | [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane |
| PubChem CID | 123969489 |
| Molecular Formula | C11H12Cl2FNOSi |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane |
| SMILES | [C-]#[N+]C(O[Si](C)(C)C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C11H12Cl2FNOSi/c1-15-11(16-17(2,3)4)9-7(12)5-6-8(14)10(9)13/h5-6,11H,2-4H3 |
| InChIKey | ZSDYIKYDAZUPQM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane?
The IUPAC name of [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane (CID 123969489) is [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane.
What is the SMILES notation for [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane?
The canonical SMILES for [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane is [C-]#[N+]C(O[Si](C)(C)C)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane?
The InChIKey is ZSDYIKYDAZUPQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2FNOSi/c1-15-11(16-17(2,3)4)9-7(12)5-6-8(14)10(9)13/h5-6,11H,2-4H3.
What are the key properties of [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane?
[(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane has a molecular weight of 292.21 g/mol, XLogP of 4.90, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,6-dichloro-3-fluorophenyl)-isocyanomethoxy]-trimethylsilane is sourced from PubChem (CID 123969489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).