C14H31NS — CID 123969535
6-(1,1-dimethylthiiran-2-yl)-N,2,2,3-tetramethylhexan-1-amine (PubChem CID 123969535) has the molecular formula C14H31NS and a molecular weight of 245.48 g/mol. Its IUPAC name is 6-(1,1-dimethylthiiran-2-yl)-N,2,2,3-tetramethylhexan-1-amine.
| Compound Name | 6-(1,1-dimethylthiiran-2-yl)-N,2,2,3-tetramethylhexan-1-amine |
|---|---|
| PubChem CID | 123969535 |
| Molecular Formula | C14H31NS |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | 6-(1,1-dimethylthiiran-2-yl)-N,2,2,3-tetramethylhexan-1-amine |
| SMILES | CNCC(C)(C)C(C)CCCC1CS1(C)C |
| InChI | InChI=1S/C14H31NS/c1-12(14(2,3)11-15-4)8-7-9-13-10-16(13,5)6/h12-13,15H,7-11H2,1-6H3 |
| InChIKey | CUFVYTPOUFONLG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|