C25H25N3O2S — CID 1239697
2-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N,N-diethylacetamide (PubChem CID 1239697) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N,N-diethylacetamide.
| Compound Name | 2-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 1239697 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nc(-c2ccccc2)cc(-c2ccc(OC)cc2)c1C#N |
| InChI | InChI=1S/C25H25N3O2S/c1-4-28(5-2)24(29)17-31-25-22(16-26)21(18-11-13-20(30-3)14-12-18)15-23(27-25)19-9-7-6-8-10-19/h6-15H,4-5,17H2,1-3H3 |
| InChIKey | VMADYBYSWYURDQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|