About 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid
2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid (PubChem CID 123970251) has the molecular formula C10H22O6S2
and a molecular weight of 302.41 g/mol. Its IUPAC name is 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid.
Molecular Properties
| Compound Name | 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid |
| PubChem CID | 123970251 |
| Molecular Formula | C10H22O6S2 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid |
| SMILES | CCC(C)(C)C(CS(=O)(=O)O)C(C)CS(=O)(=O)O |
| InChI | InChI=1S/C10H22O6S2/c1-5-10(3,4)9(7-18(14,15)16)8(2)6-17(11,12)13/h8-9H,5-7H2,1-4H3,(H,11,12,13)(H,14,15,16) |
| InChIKey | DSGOGYKEIARDND-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid?
The IUPAC name of 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid (CID 123970251) is 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid.
What is the SMILES notation for 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid?
The canonical SMILES for 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid is CCC(C)(C)C(CS(=O)(=O)O)C(C)CS(=O)(=O)O.
What is the InChIKey of 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid?
The InChIKey is DSGOGYKEIARDND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O6S2/c1-5-10(3,4)9(7-18(14,15)16)8(2)6-17(11,12)13/h8-9H,5-7H2,1-4H3,(H,11,12,13)(H,14,15,16).
What are the key properties of 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid?
2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid has a molecular weight of 302.41 g/mol, XLogP of 1.45, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(2-methylbutan-2-yl)butane-1,4-disulfonic acid is sourced from PubChem (CID 123970251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).