C38H34N4O6 — CID 123970395
(15-cyano-28-methyl-7,9,22,24-tetraoxa-14,28-diazaheptacyclo[14.11.1.02,14.04,12.06,10.019,27.021,25]octacosa-4,6(10),11,19,21(25),26-hexaen-13-yl)methyl 4-quinolin-3-ylbut-2-enoate (PubChem CID 123970395) has the molecular formula C38H34N4O6 and a molecular weight of 642.71 g/mol. Its IUPAC name is (15-cyano-28-methyl-7,9,22,24-tetraoxa-14,28-diazaheptacyclo[14.11.1.02,14.04,12.06,10.019,27.021,25]octacosa-4,6(10),11,19,21(25),26-hexaen-13-yl)methyl 4-quinolin-3-ylbut-2-enoate.
| Compound Name | (15-cyano-28-methyl-7,9,22,24-tetraoxa-14,28-diazaheptacyclo[14.11.1.02,14.04,12.06,10.019,27.021,25]octacosa-4,6(10),11,19,21(25),26-hexaen-13-yl)methyl 4-quinolin-3-ylbut-2-enoate |
|---|---|
| PubChem CID | 123970395 |
| Molecular Formula | C38H34N4O6 |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | (15-cyano-28-methyl-7,9,22,24-tetraoxa-14,28-diazaheptacyclo[14.11.1.02,14.04,12.06,10.019,27.021,25]octacosa-4,6(10),11,19,21(25),26-hexaen-13-yl)methyl 4-quinolin-3-ylbut-2-enoate |
| SMILES | CN1C2CCc3cc4c(cc3C1C1Cc3cc5c(cc3C(COC(=O)C=CCc3cnc6ccccc6c3)N1C2C#N)OCO5)OCO4 |
| InChI | InChI=1S/C38H34N4O6/c1-41-29-10-9-23-13-33-36(48-20-45-33)16-27(23)38(41)30-12-25-14-34-35(47-21-46-34)15-26(25)32(42(30)31(29)17-39)19-44-37(43)8-4-5-22-11-24-6-2-3-7-28(24)40-18-22/h2-4,6-8,11,13-16,18,29-32,38H,5,9-10,12,19-21H2,1H3 |
| InChIKey | KEHAFQUTNJQBSU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 106.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|