C18H25ClN2O — CID 123970515
3-chloro-N-[(1E)-3-methyl-2-(2-methylpropylideneamino)buta-1,3-dienyl]-2-prop-1-en-2-ylhexa-2,4-dienamide (PubChem CID 123970515) has the molecular formula C18H25ClN2O and a molecular weight of 320.86 g/mol. Its IUPAC name is 3-chloro-N-[(1E)-3-methyl-2-(2-methylpropylideneamino)buta-1,3-dienyl]-2-prop-1-en-2-ylhexa-2,4-dienamide.
| Compound Name | 3-chloro-N-[(1E)-3-methyl-2-(2-methylpropylideneamino)buta-1,3-dienyl]-2-prop-1-en-2-ylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 123970515 |
| Molecular Formula | C18H25ClN2O |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 3-chloro-N-[(1E)-3-methyl-2-(2-methylpropylideneamino)buta-1,3-dienyl]-2-prop-1-en-2-ylhexa-2,4-dienamide |
| SMILES | C=C(C)C(C(=O)N/C=C(/N=C/C(C)C)C(=C)C)=C(Cl)C=CC |
| InChI | InChI=1S/C18H25ClN2O/c1-8-9-15(19)17(14(6)7)18(22)21-11-16(13(4)5)20-10-12(2)3/h8-12H,4,6H2,1-3,5,7H3,(H,21,22)/b9-8?,16-11+,17-15?,20-10+ |
| InChIKey | OHZGKOAHSZDONB-KQCZSJIBSA-N |
| XLogP | 4.89 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|