C35H43NO6 — CID 123970681
tert-butyl N-[(1S,2R,3R,4R,5S)-2,3-bis(phenylmethoxy)-1-(3-phenylpropyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]-N-methylcarbamate (PubChem CID 123970681) has the molecular formula C35H43NO6 and a molecular weight of 573.73 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R,3R,4R,5S)-2,3-bis(phenylmethoxy)-1-(3-phenylpropyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1S,2R,3R,4R,5S)-2,3-bis(phenylmethoxy)-1-(3-phenylpropyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123970681 |
| Molecular Formula | C35H43NO6 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | tert-butyl N-[(1S,2R,3R,4R,5S)-2,3-bis(phenylmethoxy)-1-(3-phenylpropyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H]1[C@H]2OC[C@](CCCc3ccccc3)(O2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H43NO6/c1-34(2,3)42-33(37)36(4)29-30(38-23-27-17-10-6-11-18-27)31(39-24-28-19-12-7-13-20-28)35(25-40-32(29)41-35)22-14-21-26-15-8-5-9-16-26/h5-13,15-20,29-32H,14,21-25H2,1-4H3/t29-,30-,31-,32+,35+/m1/s1 |
| InChIKey | AHHRGTDFZIGXPQ-KLIJISJASA-N |
| XLogP | 6.54 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |