C22H28BNO4 — CID 123970903
(4Z)-6-[[(5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-2-(2-phenylethenyl)-1,3,6,2-dioxazaborocine-4,8-diol (PubChem CID 123970903) has the molecular formula C22H28BNO4 and a molecular weight of 381.28 g/mol. Its IUPAC name is (4Z)-6-[[(5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-2-(2-phenylethenyl)-1,3,6,2-dioxazaborocine-4,8-diol.
| Compound Name | (4Z)-6-[[(5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-2-(2-phenylethenyl)-1,3,6,2-dioxazaborocine-4,8-diol |
|---|---|
| PubChem CID | 123970903 |
| Molecular Formula | C22H28BNO4 |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (4Z)-6-[[(5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-2-(2-phenylethenyl)-1,3,6,2-dioxazaborocine-4,8-diol |
| SMILES | CC1(C)C2C[C@H]1CCC2CN1C=C(O)OB(C=Cc2ccccc2)O/C(O)=C\1 |
| InChI | InChI=1S/C22H28BNO4/c1-22(2)18-9-8-17(19(22)12-18)13-24-14-20(25)27-23(28-21(26)15-24)11-10-16-6-4-3-5-7-16/h3-7,10-11,14-15,17-19,25-26H,8-9,12-13H2,1-2H3/b11-10?,20-14-,21-15?/t17?,18-,19?/m1/s1 |
| InChIKey | UZGBGEOWXKGXLX-BIBPMYECSA-N |
| XLogP | 4.86 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|