C16H26BF2N3O2 — CID 123971222
1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 123971222) has the molecular formula C16H26BF2N3O2 and a molecular weight of 341.21 g/mol. Its IUPAC name is 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 123971222 |
| Molecular Formula | C16H26BF2N3O2 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-[3-(3,3-difluoropyrrolidin-1-yl)propyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CC1(C)OB(c2cnn(CCCN3CCC(F)(F)C3)c2)OC1(C)C |
| InChI | InChI=1S/C16H26BF2N3O2/c1-14(2)15(3,4)24-17(23-14)13-10-20-22(11-13)8-5-7-21-9-6-16(18,19)12-21/h10-11H,5-9,12H2,1-4H3 |
| InChIKey | NNNJYIJFBPDHFU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|